Chemistry MCQ & Answers [PDF Download]
What is the hybridization of the central carbon atom in allene (C3H4)?
Calculate the pH of a 0.1 M solution of NH4Cl. (Kb for NH3 = 1.8 × 10-5)
Which of the following represents the correct order of stability for carbocations?
What is the IUPAC name for the following compound: CH3-CH(OH)-CH(CH3)-CH2-CHO?
Calculate the standard electrode potential for the cell: Zn|Zn2+(1M)||Cu2+(1M)|Cu. Given: E°(Zn2+/Zn) = -0.76V, E°(Cu2+/Cu) = +0.34V
What is the major product when 2-methylbut-2-ene undergoes ozonolysis followed by reductive workup (Zn/AcOH)?
Which of the following quantum number combinations is NOT allowed for an electron in an atom?
What is the rate law for the following elementary reaction: 2NO + O2 → 2NO2?
Calculate the wavelength of light emitted when an electron in hydrogen atom transitions from n=4 to n=2. (RH = 1.097 × 107 m-1)
What is the coordination number and oxidation state of the central metal ion in [Co(NH3)4Cl2]Cl?
Which mechanism best explains the SN2 reaction of CH3CH2Br with OH-?
Calculate the molarity of H2SO4 if 25.0 mL requires 20.0 mL of 0.1 M NaOH for complete neutralization.
What is the major product of the Friedel-Crafts acylation of benzene with acetyl chloride in the presence of AlCl3?
Calculate the entropy change (ΔS) for the vaporization of 1 mole of water at 100°C. Given: ΔHvap = 40.7 kJ/mol
Which of the following represents the correct electron configuration for Cr3+ ion?
Calculate the pH of a buffer solution containing 0.1 M CH3COOH and 0.15 M CH3COONa. (Ka for acetic acid = 1.8 × 10-5)
What is the molecular geometry of SF4 according to VSEPR theory?
Calculate the half-life of a first-order reaction with a rate constant of 2.3 × 10-3 s-1.
Which of the following compounds exhibits optical isomerism?
Calculate the formal charge on the nitrogen atom in the nitrate ion (NO3-) using the most stable resonance structure.
What is the major product when cyclohexene reacts with Br2 in the presence of water?
Calculate the number of unpaired electrons in Fe2+ ion (high spin configuration).
What is the product of the following reaction: CH3CH2CHO + NH3 + H2 → ?
Calculate the bond order of the nitrogen molecule (N2) using molecular orbital theory.
Which of the following reactions represents an E2 elimination mechanism?
Calculate the pH of a 0.01 M solution of Ba(OH)2.
What is the major product of the Diels-Alder reaction between 1,3-butadiene and maleic anhydride?
Calculate the equilibrium constant (Keq) for the reaction at 298 K: A + B ⇌ C + D, given ΔG° = -5.7 kJ/mol
Which of the following represents the correct order of increasing basicity in aqueous solution?
Calculate the mass of CO2 produced when 5.0 g of C2H6 undergoes complete combustion.
What is the hybridization state of the central atom in ClF3?
Calculate the cell potential for the following electrochemical cell at 25°C: Zn|Zn2+(0.1M)||Ag+(0.01M)|Ag. Given: E°(Zn2+/Zn) = -0.76V, E°(Ag+/Ag) = +0.80V
Which of the following represents the correct resonance structure with the lowest formal charges for SO2?
Calculate the concentration of H3O+ in a 0.1 M solution of HF. (Ka = 6.8 × 10-4)
What is the major product when 2-methyl-2-butene undergoes acid-catalyzed hydration?
Calculate the number of sigma (σ) and pi (π) bonds in HC≡C-CH=CH₂.
Which of the following correctly describes the magnetic properties of [Fe(CN)6]4-?